C29H34N2O3 — CID 67671153
[3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-2-amino-1-benzofuran-5-yl]-(3-hexoxyphenyl)methanone (PubChem CID 67671153) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is [3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-2-amino-1-benzofuran-5-yl]-(3-hexoxyphenyl)methanone.
| Compound Name | [3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-2-amino-1-benzofuran-5-yl]-(3-hexoxyphenyl)methanone |
|---|---|
| PubChem CID | 67671153 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | [3-(1,2,3,5,8,8a-hexahydroindolizin-7-yl)-2-amino-1-benzofuran-5-yl]-(3-hexoxyphenyl)methanone |
| SMILES | CCCCCCOc1cccc(C(=O)c2ccc3oc(N)c(C4=CCN5CCCC5C4)c3c2)c1 |
| InChI | InChI=1S/C29H34N2O3/c1-2-3-4-5-16-33-24-10-6-8-21(18-24)28(32)22-11-12-26-25(19-22)27(29(30)34-26)20-13-15-31-14-7-9-23(31)17-20/h6,8,10-13,18-19,23H,2-5,7,9,14-17,30H2,1H3 |
| InChIKey | ZAINEQWYYQXCKV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|