C33H45N3O2 — CID 151304842
[1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(3-heptoxyphenyl)methanone (PubChem CID 151304842) has the molecular formula C33H45N3O2 and a molecular weight of 515.74 g/mol. Its IUPAC name is [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(3-heptoxyphenyl)methanone.
| Compound Name | [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(3-heptoxyphenyl)methanone |
|---|---|
| PubChem CID | 151304842 |
| Molecular Formula | C33H45N3O2 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.35 |
| IUPAC Name | [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(3-heptoxyphenyl)methanone |
| SMILES | CCCCCCCOc1cccc(C(=O)c2ccc3c(c2)c(C2=CCN(CCCCCC)CC2)cn3N)c1 |
| InChI | InChI=1S/C33H45N3O2/c1-3-5-7-9-11-22-38-29-14-12-13-27(23-29)33(37)28-15-16-32-30(24-28)31(25-36(32)34)26-17-20-35(21-18-26)19-10-8-6-4-2/h12-17,23-25H,3-11,18-22,34H2,1-2H3 |
| InChIKey | ODEJVHGCPZZIFE-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|