C20H22Cl2N6 — CID 67672739
5-[(2-amino-5-phenyl-1H-imidazol-4-yl)imino]-7,8-dihydro-6H-naphthalene-1-carboximidamide;dihydrochloride (PubChem CID 67672739) has the molecular formula C20H22Cl2N6 and a molecular weight of 417.34 g/mol. Its IUPAC name is 5-[(2-amino-5-phenyl-1H-imidazol-4-yl)imino]-7,8-dihydro-6H-naphthalene-1-carboximidamide;dihydrochloride.
| Compound Name | 5-[(2-amino-5-phenyl-1H-imidazol-4-yl)imino]-7,8-dihydro-6H-naphthalene-1-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 67672739 |
| Molecular Formula | C20H22Cl2N6 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 5-[(2-amino-5-phenyl-1H-imidazol-4-yl)imino]-7,8-dihydro-6H-naphthalene-1-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1cccc2c1CCCC2=Nc1nc(N)[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C20H20N6.2ClH/c21-18(22)15-10-4-9-14-13(15)8-5-11-16(14)24-19-17(25-20(23)26-19)12-6-2-1-3-7-12;;/h1-4,6-7,9-10H,5,8,11H2,(H3,21,22)(H3,23,25,26);2*1H |
| InChIKey | ONETVJUOAGOODI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|