C9H16N2O3 — CID 67691617
2-amino-2-[(2R)-pyrrolidine-2-carbonyl]butanoic acid (PubChem CID 67691617) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-amino-2-[(2R)-pyrrolidine-2-carbonyl]butanoic acid.
| Compound Name | 2-amino-2-[(2R)-pyrrolidine-2-carbonyl]butanoic acid |
|---|---|
| PubChem CID | 67691617 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-amino-2-[(2R)-pyrrolidine-2-carbonyl]butanoic acid |
| SMILES | CCC(N)(C(=O)O)C(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C9H16N2O3/c1-2-9(10,8(13)14)7(12)6-4-3-5-11-6/h6,11H,2-5,10H2,1H3,(H,13,14)/t6-,9?/m1/s1 |
| InChIKey | KKFKUXVTPUYOCI-VJSCVCEBSA-N |
| XLogP | -0.50 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|