C8H15N3O3 — CID 68516841
2-amino-2-(aminomethyl)-3-oxo-3-[(2S)-pyrrolidin-2-yl]propanoic acid (PubChem CID 68516841) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is 2-amino-2-(aminomethyl)-3-oxo-3-[(2S)-pyrrolidin-2-yl]propanoic acid.
| Compound Name | 2-amino-2-(aminomethyl)-3-oxo-3-[(2S)-pyrrolidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 68516841 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 2-amino-2-(aminomethyl)-3-oxo-3-[(2S)-pyrrolidin-2-yl]propanoic acid |
| SMILES | NCC(N)(C(=O)O)C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C8H15N3O3/c9-4-8(10,7(13)14)6(12)5-2-1-3-11-5/h5,11H,1-4,9-10H2,(H,13,14)/t5-,8?/m0/s1 |
| InChIKey | POZUMYAWEBOPKP-NTFOPCPOSA-N |
| XLogP | -1.95 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|