C18H21NO6S — CID 67703059
methyl 2-[(2E)-2-[(4-acetyloxy-3-methoxy-5-methylphenyl)methylidene]-3-oxothiomorpholin-4-yl]acetate (PubChem CID 67703059) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is methyl 2-[(2E)-2-[(4-acetyloxy-3-methoxy-5-methylphenyl)methylidene]-3-oxothiomorpholin-4-yl]acetate.
| Compound Name | methyl 2-[(2E)-2-[(4-acetyloxy-3-methoxy-5-methylphenyl)methylidene]-3-oxothiomorpholin-4-yl]acetate |
|---|---|
| PubChem CID | 67703059 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | methyl 2-[(2E)-2-[(4-acetyloxy-3-methoxy-5-methylphenyl)methylidene]-3-oxothiomorpholin-4-yl]acetate |
| SMILES | COC(=O)CN1CCS/C(=C/c2cc(C)c(OC(C)=O)c(OC)c2)C1=O |
| InChI | InChI=1S/C18H21NO6S/c1-11-7-13(8-14(23-3)17(11)25-12(2)20)9-15-18(22)19(5-6-26-15)10-16(21)24-4/h7-9H,5-6,10H2,1-4H3/b15-9+ |
| InChIKey | MIAIGCJFRZRDCF-OQLLNIDSSA-N |
| XLogP | 2.02 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|