C17H16N2O4S — CID 19423092
[4-[(Z)-[4-(cyanomethyl)-3-oxo-1,4-thiazin-2-ylidene]methyl]-2-methoxy-6-methylphenyl] acetate (PubChem CID 19423092) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is [4-[(Z)-[4-(cyanomethyl)-3-oxo-1,4-thiazin-2-ylidene]methyl]-2-methoxy-6-methylphenyl] acetate.
| Compound Name | [4-[(Z)-[4-(cyanomethyl)-3-oxo-1,4-thiazin-2-ylidene]methyl]-2-methoxy-6-methylphenyl] acetate |
|---|---|
| PubChem CID | 19423092 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | [4-[(Z)-[4-(cyanomethyl)-3-oxo-1,4-thiazin-2-ylidene]methyl]-2-methoxy-6-methylphenyl] acetate |
| SMILES | COc1cc(/C=C2\SC=CN(CC#N)C2=O)cc(C)c1OC(C)=O |
| InChI | InChI=1S/C17H16N2O4S/c1-11-8-13(9-14(22-3)16(11)23-12(2)20)10-15-17(21)19(5-4-18)6-7-24-15/h6-10H,5H2,1-3H3/b15-10- |
| InChIKey | SRNQEOGVAYIPDY-GDNBJRDFSA-N |
| XLogP | 2.84 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|