C12H9BrN4S — CID 677039
8-bromo-5-prop-2-enyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione (PubChem CID 677039) has the molecular formula C12H9BrN4S and a molecular weight of 321.20 g/mol. Its IUPAC name is 8-bromo-5-prop-2-enyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione.
| Compound Name | 8-bromo-5-prop-2-enyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
|---|---|
| PubChem CID | 677039 |
| Molecular Formula | C12H9BrN4S |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 8-bromo-5-prop-2-enyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
| SMILES | C=CCn1c2ccc(Br)cc2c2n[nH]c(=S)nc21 |
| InChI | InChI=1S/C12H9BrN4S/c1-2-5-17-9-4-3-7(13)6-8(9)10-11(17)14-12(18)16-15-10/h2-4,6H,1,5H2,(H,14,16,18) |
| InChIKey | SUPTXUZPGLMYRL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|