C18H28Cl2N2O3 — CID 67706352
1-(3,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one;1,1-diethoxy-N,N-dimethylmethanamine (PubChem CID 67706352) has the molecular formula C18H28Cl2N2O3 and a molecular weight of 391.34 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one;1,1-diethoxy-N,N-dimethylmethanamine.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one;1,1-diethoxy-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 67706352 |
| Molecular Formula | C18H28Cl2N2O3 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one;1,1-diethoxy-N,N-dimethylmethanamine |
| SMILES | CCOC(OCC)N(C)C.CN(C)C=CC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO.C7H17NO2/c1-14(2)6-5-11(15)8-3-4-9(12)10(13)7-8;1-5-9-7(8(3)4)10-6-2/h3-7H,1-2H3;7H,5-6H2,1-4H3 |
| InChIKey | IJQNROTXPXWVCT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|