C30H31ClN4O5 — CID 67709613
methyl 2-[2-[3-(4-carbamimidoylphenyl)prop-2-enoylamino]ethyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetate;hydrochloride (PubChem CID 67709613) has the molecular formula C30H31ClN4O5 and a molecular weight of 563.05 g/mol. Its IUPAC name is methyl 2-[2-[3-(4-carbamimidoylphenyl)prop-2-enoylamino]ethyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetate;hydrochloride.
| Compound Name | methyl 2-[2-[3-(4-carbamimidoylphenyl)prop-2-enoylamino]ethyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 67709613 |
| Molecular Formula | C30H31ClN4O5 |
| Molecular Weight | 563.05 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | methyl 2-[2-[3-(4-carbamimidoylphenyl)prop-2-enoylamino]ethyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(C=CC(=O)NCCN(CC(=O)OC)C(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C30H30N4O5.ClH/c1-38-28(36)18-34(17-16-33-27(35)15-12-20-10-13-21(14-11-20)29(31)32)30(37)39-19-26-24-8-4-2-6-22(24)23-7-3-5-9-25(23)26;/h2-15,26H,16-19H2,1H3,(H3,31,32)(H,33,35);1H |
| InChIKey | SYEFIUKIQDVJCT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.05 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|