C18H16N4O4S — CID 67711530
3-[4-[5-(4-carbamimidoylphenyl)-1,1-dioxo-1,2,5-thiadiazol-2-yl]phenyl]prop-2-enoic acid (PubChem CID 67711530) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is 3-[4-[5-(4-carbamimidoylphenyl)-1,1-dioxo-1,2,5-thiadiazol-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[5-(4-carbamimidoylphenyl)-1,1-dioxo-1,2,5-thiadiazol-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67711530 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 3-[4-[5-(4-carbamimidoylphenyl)-1,1-dioxo-1,2,5-thiadiazol-2-yl]phenyl]prop-2-enoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2C=CN(c3ccc(C=CC(=O)O)cc3)S2(=O)=O)cc1 |
| InChI | InChI=1S/C18H16N4O4S/c19-18(20)14-4-8-16(9-5-14)22-12-11-21(27(22,25)26)15-6-1-13(2-7-15)3-10-17(23)24/h1-12H,(H3,19,20)(H,23,24) |
| InChIKey | JPHVHJIPBCGXJE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|