C10H10N4O2 — CID 67713840
2,3,4a,5,10,10a-hexahydropyridazino[4,5-b]quinoxaline-1,4-dione (PubChem CID 67713840) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 2,3,4a,5,10,10a-hexahydropyridazino[4,5-b]quinoxaline-1,4-dione.
| Compound Name | 2,3,4a,5,10,10a-hexahydropyridazino[4,5-b]quinoxaline-1,4-dione |
|---|---|
| PubChem CID | 67713840 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2,3,4a,5,10,10a-hexahydropyridazino[4,5-b]quinoxaline-1,4-dione |
| SMILES | O=C1NNC(=O)C2Nc3ccccc3NC12 |
| InChI | InChI=1S/C10H10N4O2/c15-9-7-8(10(16)14-13-9)12-6-4-2-1-3-5(6)11-7/h1-4,7-8,11-12H,(H,13,15)(H,14,16) |
| InChIKey | ZWQOVCMCMHGZRW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|