C8H13Br2NO3 — CID 67722090
(1S)-6,7-dibromo-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol (PubChem CID 67722090) has the molecular formula C8H13Br2NO3 and a molecular weight of 331.00 g/mol. Its IUPAC name is (1S)-6,7-dibromo-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol.
| Compound Name | (1S)-6,7-dibromo-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol |
|---|---|
| PubChem CID | 67722090 |
| Molecular Formula | C8H13Br2NO3 |
| Molecular Weight | 331.00 g/mol |
| Exact Mass | 328.93 |
| IUPAC Name | (1S)-6,7-dibromo-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol |
| SMILES | OC1C(Br)C(Br)CN2CC(O)[C@@H](O)C12 |
| InChI | InChI=1S/C8H13Br2NO3/c9-3-1-11-2-4(12)7(13)6(11)8(14)5(3)10/h3-8,12-14H,1-2H2/t3?,4?,5?,6?,7-,8?/m1/s1 |
| InChIKey | LELXLDUPJPORMZ-RRQYHCINSA-N |
| XLogP | -0.71 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.00 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|