C33H39NO6S — CID 67725148
(E)-3-[6-[(3-methoxycarbonylphenyl)methylsulfanylmethyl]-2-pyridinyl]-2-[8-(4-methoxyphenyl)octoxy]prop-2-enoic acid (PubChem CID 67725148) has the molecular formula C33H39NO6S and a molecular weight of 577.74 g/mol. Its IUPAC name is (E)-3-[6-[(3-methoxycarbonylphenyl)methylsulfanylmethyl]-2-pyridinyl]-2-[8-(4-methoxyphenyl)octoxy]prop-2-enoic acid.
| Compound Name | (E)-3-[6-[(3-methoxycarbonylphenyl)methylsulfanylmethyl]-2-pyridinyl]-2-[8-(4-methoxyphenyl)octoxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 67725148 |
| Molecular Formula | C33H39NO6S |
| Molecular Weight | 577.74 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | (E)-3-[6-[(3-methoxycarbonylphenyl)methylsulfanylmethyl]-2-pyridinyl]-2-[8-(4-methoxyphenyl)octoxy]prop-2-enoic acid |
| SMILES | COC(=O)c1cccc(CSCc2cccc(/C=C(/OCCCCCCCCc3ccc(OC)cc3)C(=O)O)n2)c1 |
| InChI | InChI=1S/C33H39NO6S/c1-38-30-18-16-25(17-19-30)11-7-5-3-4-6-8-20-40-31(32(35)36)22-28-14-10-15-29(34-28)24-41-23-26-12-9-13-27(21-26)33(37)39-2/h9-10,12-19,21-22H,3-8,11,20,23-24H2,1-2H3,(H,35,36)/b31-22+ |
| InChIKey | PTOZFBPXPFKODE-DFKUXCBWSA-N |
| XLogP | 7.34 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.74 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|