C25H23Cl2NO3S — CID 67583751
(E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-2-(4-phenylbutoxy)prop-2-enoic acid (PubChem CID 67583751) has the molecular formula C25H23Cl2NO3S and a molecular weight of 488.44 g/mol. Its IUPAC name is (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-2-(4-phenylbutoxy)prop-2-enoic acid.
| Compound Name | (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-2-(4-phenylbutoxy)prop-2-enoic acid |
|---|---|
| PubChem CID | 67583751 |
| Molecular Formula | C25H23Cl2NO3S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-2-(4-phenylbutoxy)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1cccc(CSc2c(Cl)cccc2Cl)n1)OCCCCc1ccccc1 |
| InChI | InChI=1S/C25H23Cl2NO3S/c26-21-13-7-14-22(27)24(21)32-17-20-12-6-11-19(28-20)16-23(25(29)30)31-15-5-4-10-18-8-2-1-3-9-18/h1-3,6-9,11-14,16H,4-5,10,15,17H2,(H,29,30)/b23-16+ |
| InChIKey | RKOQHSZXFZKUMZ-XQNSMLJCSA-N |
| XLogP | 7.15 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|