C25H22Cl2FNO3S — CID 67584936
2-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-3-[4-(4-fluorophenyl)butoxy]prop-2-enoic acid (PubChem CID 67584936) has the molecular formula C25H22Cl2FNO3S and a molecular weight of 506.43 g/mol. Its IUPAC name is 2-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-3-[4-(4-fluorophenyl)butoxy]prop-2-enoic acid.
| Compound Name | 2-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-3-[4-(4-fluorophenyl)butoxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 67584936 |
| Molecular Formula | C25H22Cl2FNO3S |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 2-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-3-[4-(4-fluorophenyl)butoxy]prop-2-enoic acid |
| SMILES | O=C(O)C(=COCCCCc1ccc(F)cc1)c1cccc(CSc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C25H22Cl2FNO3S/c26-21-7-4-8-22(27)24(21)33-16-19-6-3-9-23(29-19)20(25(30)31)15-32-14-2-1-5-17-10-12-18(28)13-11-17/h3-4,6-13,15H,1-2,5,14,16H2,(H,30,31) |
| InChIKey | LNNHVRYHXZAXPR-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|