C23H16Cl3FNO3S- — CID 19037986
(E)-3-[3-[2-(4-fluorophenyl)ethoxy]-6-[(2,4,6-trichlorophenyl)sulfanylmethyl]-2-pyridinyl]prop-2-enoate (PubChem CID 19037986) has the molecular formula C23H16Cl3FNO3S- and a molecular weight of 511.81 g/mol. Its IUPAC name is (E)-3-[3-[2-(4-fluorophenyl)ethoxy]-6-[(2,4,6-trichlorophenyl)sulfanylmethyl]-2-pyridinyl]prop-2-enoate.
| Compound Name | (E)-3-[3-[2-(4-fluorophenyl)ethoxy]-6-[(2,4,6-trichlorophenyl)sulfanylmethyl]-2-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 19037986 |
| Molecular Formula | C23H16Cl3FNO3S- |
| Molecular Weight | 511.81 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | (E)-3-[3-[2-(4-fluorophenyl)ethoxy]-6-[(2,4,6-trichlorophenyl)sulfanylmethyl]-2-pyridinyl]prop-2-enoate |
| SMILES | O=C([O-])/C=C/c1nc(CSc2c(Cl)cc(Cl)cc2Cl)ccc1OCCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H17Cl3FNO3S/c24-15-11-18(25)23(19(26)12-15)32-13-17-5-7-21(20(28-17)6-8-22(29)30)31-10-9-14-1-3-16(27)4-2-14/h1-8,11-12H,9-10,13H2,(H,29,30)/p-1/b8-6+ |
| InChIKey | NDLUZRDRUIAJFY-SOFGYWHQSA-M |
| XLogP | 5.86 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.81 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|