C27H29NO4S — CID 54480168
methyl 3-[3-[4-(4-methoxyphenyl)butoxy]-6-(phenylsulfanylmethyl)-2-pyridinyl]prop-2-enoate (PubChem CID 54480168) has the molecular formula C27H29NO4S and a molecular weight of 463.60 g/mol. Its IUPAC name is methyl 3-[3-[4-(4-methoxyphenyl)butoxy]-6-(phenylsulfanylmethyl)-2-pyridinyl]prop-2-enoate.
| Compound Name | methyl 3-[3-[4-(4-methoxyphenyl)butoxy]-6-(phenylsulfanylmethyl)-2-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 54480168 |
| Molecular Formula | C27H29NO4S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | methyl 3-[3-[4-(4-methoxyphenyl)butoxy]-6-(phenylsulfanylmethyl)-2-pyridinyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1nc(CSc2ccccc2)ccc1OCCCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H29NO4S/c1-30-23-14-11-21(12-15-23)8-6-7-19-32-26-17-13-22(20-33-24-9-4-3-5-10-24)28-25(26)16-18-27(29)31-2/h3-5,9-18H,6-8,19-20H2,1-2H3 |
| InChIKey | XOLBXVYSLZMAQF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|