C31H33NO7-2 — CID 23257863
3-[[6-[(E)-2-carboxylatoethenyl]-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]methoxy]benzoate (PubChem CID 23257863) has the molecular formula C31H33NO7-2 and a molecular weight of 531.61 g/mol. Its IUPAC name is 3-[[6-[(E)-2-carboxylatoethenyl]-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]methoxy]benzoate.
| Compound Name | 3-[[6-[(E)-2-carboxylatoethenyl]-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]methoxy]benzoate |
|---|---|
| PubChem CID | 23257863 |
| Molecular Formula | C31H33NO7-2 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 3-[[6-[(E)-2-carboxylatoethenyl]-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]methoxy]benzoate |
| SMILES | COc1ccc(CCCCCCCCOc2ccc(COc3cccc(C(=O)[O-])c3)nc2/C=C/C(=O)[O-])cc1 |
| InChI | InChI=1S/C31H35NO7/c1-37-26-15-12-23(13-16-26)9-6-4-2-3-5-7-20-38-29-18-14-25(32-28(29)17-19-30(33)34)22-39-27-11-8-10-24(21-27)31(35)36/h8,10-19,21H,2-7,9,20,22H2,1H3,(H,33,34)(H,35,36)/p-2/b19-17+ |
| InChIKey | PGTNSWQHLFEFDD-HTXNQAPBSA-L |
| XLogP | 3.76 |
| TPSA | 120.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|