C29H37N3O4S — CID 67811287
3-[3-[8-(4-methoxyphenyl)octoxy]-6-[(1-methylimidazol-2-yl)methylsulfanylmethyl]-2-pyridinyl]prop-2-enoic acid (PubChem CID 67811287) has the molecular formula C29H37N3O4S and a molecular weight of 523.70 g/mol. Its IUPAC name is 3-[3-[8-(4-methoxyphenyl)octoxy]-6-[(1-methylimidazol-2-yl)methylsulfanylmethyl]-2-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[3-[8-(4-methoxyphenyl)octoxy]-6-[(1-methylimidazol-2-yl)methylsulfanylmethyl]-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67811287 |
| Molecular Formula | C29H37N3O4S |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | 3-[3-[8-(4-methoxyphenyl)octoxy]-6-[(1-methylimidazol-2-yl)methylsulfanylmethyl]-2-pyridinyl]prop-2-enoic acid |
| SMILES | COc1ccc(CCCCCCCCOc2ccc(CSCc3nccn3C)nc2C=CC(=O)O)cc1 |
| InChI | InChI=1S/C29H37N3O4S/c1-32-19-18-30-28(32)22-37-21-24-12-16-27(26(31-24)15-17-29(33)34)36-20-8-6-4-3-5-7-9-23-10-13-25(35-2)14-11-23/h10-19H,3-9,20-22H2,1-2H3,(H,33,34) |
| InChIKey | KKTSRFIKOQTFGX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|