C32H37NO6 — CID 67584479
3-[6-[(E)-2-carboxyethenyl]-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]-2-ethylbenzoic acid (PubChem CID 67584479) has the molecular formula C32H37NO6 and a molecular weight of 531.65 g/mol. Its IUPAC name is 3-[6-[(E)-2-carboxyethenyl]-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]-2-ethylbenzoic acid.
| Compound Name | 3-[6-[(E)-2-carboxyethenyl]-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]-2-ethylbenzoic acid |
|---|---|
| PubChem CID | 67584479 |
| Molecular Formula | C32H37NO6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 3-[6-[(E)-2-carboxyethenyl]-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]-2-ethylbenzoic acid |
| SMILES | CCc1c(C(=O)O)cccc1-c1ccc(OCCCCCCCCc2ccc(OC)cc2)c(/C=C/C(=O)O)n1 |
| InChI | InChI=1S/C32H37NO6/c1-3-25-26(12-10-13-27(25)32(36)37)28-18-20-30(29(33-28)19-21-31(34)35)39-22-9-7-5-4-6-8-11-23-14-16-24(38-2)17-15-23/h10,12-21H,3-9,11,22H2,1-2H3,(H,34,35)(H,36,37)/b21-19+ |
| InChIKey | BPVBFQXMRVGRHR-XUTLUUPISA-N |
| XLogP | 7.08 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|