C26H26ClNO4S — CID 56983072
3-[6-[(3-chlorophenyl)sulfanylmethyl]-3-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]prop-2-enoic acid (PubChem CID 56983072) has the molecular formula C26H26ClNO4S and a molecular weight of 484.02 g/mol. Its IUPAC name is 3-[6-[(3-chlorophenyl)sulfanylmethyl]-3-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[6-[(3-chlorophenyl)sulfanylmethyl]-3-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 56983072 |
| Molecular Formula | C26H26ClNO4S |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 3-[6-[(3-chlorophenyl)sulfanylmethyl]-3-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]prop-2-enoic acid |
| SMILES | COc1ccc(CCCCOc2ccc(CSc3cccc(Cl)c3)nc2C=CC(=O)O)cc1 |
| InChI | InChI=1S/C26H26ClNO4S/c1-31-22-11-8-19(9-12-22)5-2-3-16-32-25-14-10-21(28-24(25)13-15-26(29)30)18-33-23-7-4-6-20(27)17-23/h4,6-15,17H,2-3,5,16,18H2,1H3,(H,29,30) |
| InChIKey | UNVQTYUHCBBHBR-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|