C28H29NO7S — CID 67711250
3-[2-[[6-(2-carboxyethenyl)-5-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]sulfanyl]-2-hydroxyethyl]benzoic acid (PubChem CID 67711250) has the molecular formula C28H29NO7S and a molecular weight of 523.61 g/mol. Its IUPAC name is 3-[2-[[6-(2-carboxyethenyl)-5-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]sulfanyl]-2-hydroxyethyl]benzoic acid.
| Compound Name | 3-[2-[[6-(2-carboxyethenyl)-5-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]sulfanyl]-2-hydroxyethyl]benzoic acid |
|---|---|
| PubChem CID | 67711250 |
| Molecular Formula | C28H29NO7S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 3-[2-[[6-(2-carboxyethenyl)-5-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]sulfanyl]-2-hydroxyethyl]benzoic acid |
| SMILES | COc1ccc(CCCCOc2ccc(SC(O)Cc3cccc(C(=O)O)c3)nc2C=CC(=O)O)cc1 |
| InChI | InChI=1S/C28H29NO7S/c1-35-22-10-8-19(9-11-22)5-2-3-16-36-24-13-14-25(29-23(24)12-15-26(30)31)37-27(32)18-20-6-4-7-21(17-20)28(33)34/h4,6-15,17,27,32H,2-3,5,16,18H2,1H3,(H,30,31)(H,33,34) |
| InChIKey | MSUWDEUNZQQKOL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|