C35H43NO7S — CID 67711234
4-[6-[1-hydroxy-2-[4-(2-methoxy-2-oxoethyl)phenyl]ethyl]sulfanyl-3-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]but-3-enoic acid (PubChem CID 67711234) has the molecular formula C35H43NO7S and a molecular weight of 621.80 g/mol. Its IUPAC name is 4-[6-[1-hydroxy-2-[4-(2-methoxy-2-oxoethyl)phenyl]ethyl]sulfanyl-3-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]but-3-enoic acid.
| Compound Name | 4-[6-[1-hydroxy-2-[4-(2-methoxy-2-oxoethyl)phenyl]ethyl]sulfanyl-3-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]but-3-enoic acid |
|---|---|
| PubChem CID | 67711234 |
| Molecular Formula | C35H43NO7S |
| Molecular Weight | 621.80 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | 4-[6-[1-hydroxy-2-[4-(2-methoxy-2-oxoethyl)phenyl]ethyl]sulfanyl-3-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]but-3-enoic acid |
| SMILES | COC(=O)Cc1ccc(CC(O)Sc2ccc(OCCCCCCCCc3ccc(OC)cc3)c(C=CCC(=O)O)n2)cc1 |
| InChI | InChI=1S/C35H43NO7S/c1-41-29-19-17-26(18-20-29)10-7-5-3-4-6-8-23-43-31-21-22-32(36-30(31)11-9-12-33(37)38)44-35(40)25-28-15-13-27(14-16-28)24-34(39)42-2/h9,11,13-22,35,40H,3-8,10,12,23-25H2,1-2H3,(H,37,38) |
| InChIKey | JFMQKKSTRTZMCX-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 115.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.80 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|