C25H33NO5 — CID 54106704
4-[3-[8-(4-methoxyphenyl)octoxy]-6-methyl-1-oxidopyridin-1-ium-2-yl]but-3-enoic acid (PubChem CID 54106704) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is 4-[3-[8-(4-methoxyphenyl)octoxy]-6-methyl-1-oxidopyridin-1-ium-2-yl]but-3-enoic acid.
| Compound Name | 4-[3-[8-(4-methoxyphenyl)octoxy]-6-methyl-1-oxidopyridin-1-ium-2-yl]but-3-enoic acid |
|---|---|
| PubChem CID | 54106704 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 4-[3-[8-(4-methoxyphenyl)octoxy]-6-methyl-1-oxidopyridin-1-ium-2-yl]but-3-enoic acid |
| SMILES | COc1ccc(CCCCCCCCOc2ccc(C)[n+]([O-])c2C=CCC(=O)O)cc1 |
| InChI | InChI=1S/C25H33NO5/c1-20-13-18-24(23(26(20)29)11-9-12-25(27)28)31-19-8-6-4-3-5-7-10-21-14-16-22(30-2)17-15-21/h9,11,13-18H,3-8,10,12,19H2,1-2H3,(H,27,28) |
| InChIKey | NEGHWUVSRGVDMQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|