C29H29NO5 — CID 154159572
methyl (E)-3-[3-[4-(4-methoxyphenyl)butoxy]-6-(3-oxo-3-phenylprop-1-enyl)-2-pyridinyl]prop-2-enoate (PubChem CID 154159572) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is methyl (E)-3-[3-[4-(4-methoxyphenyl)butoxy]-6-(3-oxo-3-phenylprop-1-enyl)-2-pyridinyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[4-(4-methoxyphenyl)butoxy]-6-(3-oxo-3-phenylprop-1-enyl)-2-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 154159572 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | methyl (E)-3-[3-[4-(4-methoxyphenyl)butoxy]-6-(3-oxo-3-phenylprop-1-enyl)-2-pyridinyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1nc(C=CC(=O)c2ccccc2)ccc1OCCCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H29NO5/c1-33-25-15-11-22(12-16-25)8-6-7-21-35-28-19-14-24(30-26(28)17-20-29(32)34-2)13-18-27(31)23-9-4-3-5-10-23/h3-5,9-20H,6-8,21H2,1-2H3/b18-13?,20-17+ |
| InChIKey | SGJBAJUWXMFWMA-LBDUUHOCSA-N |
| XLogP | 5.57 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|