C28H39NO8S — CID 67873493
5-[[6-(2-carboxyethenyl)-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]-dihydroxy-λ4-sulfanyl]pentanoic acid (PubChem CID 67873493) has the molecular formula C28H39NO8S and a molecular weight of 549.69 g/mol. Its IUPAC name is 5-[[6-(2-carboxyethenyl)-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]-dihydroxy-λ4-sulfanyl]pentanoic acid.
| Compound Name | 5-[[6-(2-carboxyethenyl)-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]-dihydroxy-λ4-sulfanyl]pentanoic acid |
|---|---|
| PubChem CID | 67873493 |
| Molecular Formula | C28H39NO8S |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 5-[[6-(2-carboxyethenyl)-5-[8-(4-methoxyphenyl)octoxy]-2-pyridinyl]-dihydroxy-λ4-sulfanyl]pentanoic acid |
| SMILES | COc1ccc(CCCCCCCCOc2ccc(S(O)(O)CCCCC(=O)O)nc2C=CC(=O)O)cc1 |
| InChI | InChI=1S/C28H39NO8S/c1-36-23-14-12-22(13-15-23)10-6-4-2-3-5-8-20-37-25-17-18-26(29-24(25)16-19-28(32)33)38(34,35)21-9-7-11-27(30)31/h12-19,34-35H,2-11,20-21H2,1H3,(H,30,31)(H,32,33) |
| InChIKey | NNQLZGBJQREIJD-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 146.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|