C28H31NO6S — CID 19037969
(E)-3-[6-[(2,6-dimethoxyphenyl)sulfanylmethyl]-3-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]prop-2-enoic acid (PubChem CID 19037969) has the molecular formula C28H31NO6S and a molecular weight of 509.62 g/mol. Its IUPAC name is (E)-3-[6-[(2,6-dimethoxyphenyl)sulfanylmethyl]-3-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-[(2,6-dimethoxyphenyl)sulfanylmethyl]-3-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 19037969 |
| Molecular Formula | C28H31NO6S |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | (E)-3-[6-[(2,6-dimethoxyphenyl)sulfanylmethyl]-3-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]prop-2-enoic acid |
| SMILES | COc1ccc(CCCCOc2ccc(CSc3c(OC)cccc3OC)nc2/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C28H31NO6S/c1-32-22-13-10-20(11-14-22)7-4-5-18-35-24-16-12-21(29-23(24)15-17-27(30)31)19-36-28-25(33-2)8-6-9-26(28)34-3/h6,8-17H,4-5,7,18-19H2,1-3H3,(H,30,31)/b17-15+ |
| InChIKey | XHCADCAKGHRORY-BMRADRMJSA-N |
| XLogP | 5.90 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|