C26H24Cl2LiNO4S — CID 23671022
lithium (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]prop-2-enoate (PubChem CID 23671022) has the molecular formula C26H24Cl2LiNO4S and a molecular weight of 524.40 g/mol. Its IUPAC name is lithium (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]prop-2-enoate.
| Compound Name | lithium (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 23671022 |
| Molecular Formula | C26H24Cl2LiNO4S |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | lithium (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-[4-(4-methoxyphenyl)butoxy]-2-pyridinyl]prop-2-enoate |
| SMILES | COc1ccc(CCCCOc2ccc(CSc3c(Cl)cccc3Cl)nc2/C=C/C(=O)[O-])cc1.[Li+] |
| InChI | InChI=1S/C26H25Cl2NO4S.Li/c1-32-20-11-8-18(9-12-20)5-2-3-16-33-24-14-10-19(29-23(24)13-15-25(30)31)17-34-26-21(27)6-4-7-22(26)28;/h4,6-15H,2-3,5,16-17H2,1H3,(H,30,31);/q;+1/p-1/b15-13+; |
| InChIKey | HIXNXLBTDNVOBH-GVYCEHEKSA-M |
| XLogP | 2.86 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|