C24H21Cl2NO4S — CID 10529082
(E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-[2-(4-methoxyphenyl)ethoxy]-2-pyridinyl]prop-2-enoic acid (PubChem CID 10529082) has the molecular formula C24H21Cl2NO4S and a molecular weight of 490.41 g/mol. Its IUPAC name is (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-[2-(4-methoxyphenyl)ethoxy]-2-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-[2-(4-methoxyphenyl)ethoxy]-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10529082 |
| Molecular Formula | C24H21Cl2NO4S |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-[2-(4-methoxyphenyl)ethoxy]-2-pyridinyl]prop-2-enoic acid |
| SMILES | COc1ccc(CCOc2ccc(CSc3c(Cl)cccc3Cl)nc2/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C24H21Cl2NO4S/c1-30-18-8-5-16(6-9-18)13-14-31-22-11-7-17(27-21(22)10-12-23(28)29)15-32-24-19(25)3-2-4-20(24)26/h2-12H,13-15H2,1H3,(H,28,29)/b12-10+ |
| InChIKey | ZMIXFFNMHGAAHI-ZRDIBKRKSA-N |
| XLogP | 6.41 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|