C22H15Cl2FNO3S- — CID 19037974
(E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-[(4-fluorophenyl)methoxy]-2-pyridinyl]prop-2-enoate (PubChem CID 19037974) has the molecular formula C22H15Cl2FNO3S- and a molecular weight of 463.34 g/mol. Its IUPAC name is (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-[(4-fluorophenyl)methoxy]-2-pyridinyl]prop-2-enoate.
| Compound Name | (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-[(4-fluorophenyl)methoxy]-2-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 19037974 |
| Molecular Formula | C22H15Cl2FNO3S- |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | (E)-3-[6-[(2,6-dichlorophenyl)sulfanylmethyl]-3-[(4-fluorophenyl)methoxy]-2-pyridinyl]prop-2-enoate |
| SMILES | O=C([O-])/C=C/c1nc(CSc2c(Cl)cccc2Cl)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H16Cl2FNO3S/c23-17-2-1-3-18(24)22(17)30-13-16-8-10-20(19(26-16)9-11-21(27)28)29-12-14-4-6-15(25)7-5-14/h1-11H,12-13H2,(H,27,28)/p-1/b11-9+ |
| InChIKey | CHDOYCYCRUYHFH-PKNBQFBNSA-M |
| XLogP | 5.16 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|