C28H32N6O4S — CID 67732941
methyl 2-[4-[[4-methyl-6-[methyl-(N'-sulfamoylcarbamimidoyl)amino]-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 67732941) has the molecular formula C28H32N6O4S and a molecular weight of 548.67 g/mol. Its IUPAC name is methyl 2-[4-[[4-methyl-6-[methyl-(N'-sulfamoylcarbamimidoyl)amino]-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[[4-methyl-6-[methyl-(N'-sulfamoylcarbamimidoyl)amino]-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 67732941 |
| Molecular Formula | C28H32N6O4S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | methyl 2-[4-[[4-methyl-6-[methyl-(N'-sulfamoylcarbamimidoyl)amino]-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCc1nc2c(C)cc(N(C)C(N)=NS(N)(=O)=O)cc2n1Cc1ccc(-c2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C28H32N6O4S/c1-5-8-25-31-26-18(2)15-21(33(3)28(29)32-39(30,36)37)16-24(26)34(25)17-19-11-13-20(14-12-19)22-9-6-7-10-23(22)27(35)38-4/h6-7,9-16H,5,8,17H2,1-4H3,(H2,29,32)(H2,30,36,37) |
| InChIKey | VIGPEZITBYEIDR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|