C20H25NO4 — CID 67735112
(E)-6-[6-cyclopropyl-7-methyl-4-(methylamino)-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid (PubChem CID 67735112) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (E)-6-[6-cyclopropyl-7-methyl-4-(methylamino)-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid.
| Compound Name | (E)-6-[6-cyclopropyl-7-methyl-4-(methylamino)-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 67735112 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (E)-6-[6-cyclopropyl-7-methyl-4-(methylamino)-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| SMILES | CNc1c(C/C=C(\C)CCC(=O)O)c(C2CC2)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C20H25NO4/c1-11(5-9-16(22)23)4-8-14-17(13-6-7-13)12(2)15-10-25-20(24)18(15)19(14)21-3/h4,13,21H,5-10H2,1-3H3,(H,22,23)/b11-4+ |
| InChIKey | ZJFXBIAMNJVTJS-NYYWCZLTSA-N |
| XLogP | 3.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|