About (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid
(E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid (PubChem CID 70192012) has the molecular formula C17H21NO4
and a molecular weight of 303.36 g/mol. Its IUPAC name is (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid.
Molecular Properties
| Compound Name | (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |
| PubChem CID | 70192012 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |
| SMILES | C/C(=C\Cc1c(C)c(C)c2c(c1N)C(=O)OC2)CCC(=O)O |
| InChI | InChI=1S/C17H21NO4/c1-9(5-7-14(19)20)4-6-12-10(2)11(3)13-8-22-17(21)15(13)16(12)18/h4H,5-8,18H2,1-3H3,(H,19,20)/b9-4+ |
| InChIKey | LMSUKZLVECABBN-RUDMXATFSA-N |
| XLogP | 2.91 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid?
The IUPAC name of (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid (CID 70192012) is (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid.
What is the SMILES notation for (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid?
The canonical SMILES for (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid is C/C(=C\Cc1c(C)c(C)c2c(c1N)C(=O)OC2)CCC(=O)O.
What is the InChIKey of (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid?
The InChIKey is LMSUKZLVECABBN-RUDMXATFSA-N. The full InChI is InChI=1S/C17H21NO4/c1-9(5-7-14(19)20)4-6-12-10(2)11(3)13-8-22-17(21)15(13)16(12)18/h4H,5-8,18H2,1-3H3,(H,19,20)/b9-4+.
What are the key properties of (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid?
(E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid has a molecular weight of 303.36 g/mol, XLogP of 2.91, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-(4-amino-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid is sourced from PubChem (CID 70192012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).