C21H24O5 — CID 67046523
(E)-6-(4-hydroxy-7-methyl-3-oxo-6-pent-2-ynyl-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid (PubChem CID 67046523) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (E)-6-(4-hydroxy-7-methyl-3-oxo-6-pent-2-ynyl-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid.
| Compound Name | (E)-6-(4-hydroxy-7-methyl-3-oxo-6-pent-2-ynyl-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 67046523 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (E)-6-(4-hydroxy-7-methyl-3-oxo-6-pent-2-ynyl-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |
| SMILES | CCC#CCc1c(C)c2c(c(O)c1C/C=C(\C)CCC(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C21H24O5/c1-4-5-6-7-15-14(3)17-12-26-21(25)19(17)20(24)16(15)10-8-13(2)9-11-18(22)23/h8,24H,4,7,9-12H2,1-3H3,(H,22,23)/b13-8+ |
| InChIKey | XGWKSNPTMCPAQQ-MDWZMJQESA-N |
| XLogP | 3.68 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|