C28H32ClN5O6S — CID 67736396
2-[[(2S)-3-(3-carbamimidoylphenyl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]-(piperidine-2-carbonyl)amino]acetic acid;hydrochloride (PubChem CID 67736396) has the molecular formula C28H32ClN5O6S and a molecular weight of 602.11 g/mol. Its IUPAC name is 2-[[(2S)-3-(3-carbamimidoylphenyl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]-(piperidine-2-carbonyl)amino]acetic acid;hydrochloride.
| Compound Name | 2-[[(2S)-3-(3-carbamimidoylphenyl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]-(piperidine-2-carbonyl)amino]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 67736396 |
| Molecular Formula | C28H32ClN5O6S |
| Molecular Weight | 602.11 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | 2-[[(2S)-3-(3-carbamimidoylphenyl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]-(piperidine-2-carbonyl)amino]acetic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cccc(C[C@H](NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N(CC(=O)O)C(=O)C2CCCCN2)c1 |
| InChI | InChI=1S/C28H31N5O6S.ClH/c29-26(30)21-9-5-6-18(14-21)15-24(28(37)33(17-25(34)35)27(36)23-10-3-4-13-31-23)32-40(38,39)22-12-11-19-7-1-2-8-20(19)16-22;/h1-2,5-9,11-12,14,16,23-24,31-32H,3-4,10,13,15,17H2,(H3,29,30)(H,34,35);1H/t23?,24-;/m0./s1 |
| InChIKey | DPTZQAZPDONZTC-ZAPAOSNUSA-N |
| XLogP | 2.02 |
| TPSA | 182.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.11 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|