C30H35ClN4O5S — CID 67736492
1-[(2S)-3-(3-carbamimidoylphenyl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid;hydrochloride (PubChem CID 67736492) has the molecular formula C30H35ClN4O5S and a molecular weight of 599.15 g/mol. Its IUPAC name is 1-[(2S)-3-(3-carbamimidoylphenyl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[(2S)-3-(3-carbamimidoylphenyl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 67736492 |
| Molecular Formula | C30H35ClN4O5S |
| Molecular Weight | 599.15 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 1-[(2S)-3-(3-carbamimidoylphenyl)-2-(naphthalen-2-ylsulfonylamino)propanoyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cccc(C[C@H](NS(=O)(=O)c2ccc3ccccc3c2)C(=O)C2NC(C(=O)O)CC3CCCCC32)c1 |
| InChI | InChI=1S/C30H34N4O5S.ClH/c31-29(32)22-10-5-6-18(14-22)15-25(34-40(38,39)23-13-12-19-7-1-2-8-20(19)16-23)28(35)27-24-11-4-3-9-21(24)17-26(33-27)30(36)37;/h1-2,5-8,10,12-14,16,21,24-27,33-34H,3-4,9,11,15,17H2,(H3,31,32)(H,36,37);1H/t21?,24?,25-,26?,27?;/m0./s1 |
| InChIKey | WBFJKYKFIZDRED-ZUBPGTAASA-N |
| XLogP | 3.63 |
| TPSA | 162.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.15 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|