C25H23ClO3 — CID 67737839
2-[3-(4-chlorophenyl)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid (PubChem CID 67737839) has the molecular formula C25H23ClO3 and a molecular weight of 406.91 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid.
| Compound Name | 2-[3-(4-chlorophenyl)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 67737839 |
| Molecular Formula | C25H23ClO3 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid |
| SMILES | CC(C)(C#Cc1ccc2ccccc2c1)c1ccc(Cl)cc1.COC=CC(=O)O |
| InChI | InChI=1S/C21H17Cl.C4H6O3/c1-21(2,19-9-11-20(22)12-10-19)14-13-16-7-8-17-5-3-4-6-18(17)15-16;1-7-3-2-4(5)6/h3-12,15H,1-2H3;2-3H,1H3,(H,5,6) |
| InChIKey | IMMHYSQIGSOTHS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|