C29H40F3N — CID 67743855
(1R,3aS,3bS,5aR,9aR,9bS,11aR)-9a,11a-dimethyl-1-(4,4,4-trifluoro-3-methyl-3-phenylbutyl)-2,3,3a,3b,4,5,5a,6,7,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline (PubChem CID 67743855) has the molecular formula C29H40F3N and a molecular weight of 459.64 g/mol. Its IUPAC name is (1R,3aS,3bS,5aR,9aR,9bS,11aR)-9a,11a-dimethyl-1-(4,4,4-trifluoro-3-methyl-3-phenylbutyl)-2,3,3a,3b,4,5,5a,6,7,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline.
| Compound Name | (1R,3aS,3bS,5aR,9aR,9bS,11aR)-9a,11a-dimethyl-1-(4,4,4-trifluoro-3-methyl-3-phenylbutyl)-2,3,3a,3b,4,5,5a,6,7,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline |
|---|---|
| PubChem CID | 67743855 |
| Molecular Formula | C29H40F3N |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | (1R,3aS,3bS,5aR,9aR,9bS,11aR)-9a,11a-dimethyl-1-(4,4,4-trifluoro-3-methyl-3-phenylbutyl)-2,3,3a,3b,4,5,5a,6,7,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline |
| SMILES | CC(CC[C@H]1CC[C@H]2[C@@H]3CC[C@H]4NCC=C[C@]4(C)[C@H]3CC[C@]12C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C29H40F3N/c1-26-17-15-24-22(11-13-25-27(24,2)16-7-19-33-25)23(26)12-10-20(26)14-18-28(3,29(30,31)32)21-8-5-4-6-9-21/h4-9,16,20,22-25,33H,10-15,17-19H2,1-3H3/t20-,22+,23+,24+,25-,26-,27-,28?/m1/s1 |
| InChIKey | FFTRNTFNLAMOJM-DNXBVNJGSA-N |
| XLogP | 7.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|