C15H21Cl2N3O3 — CID 67746421
2-(2,4-diaminophenoxy)acetic acid;N-methylaniline;dihydrochloride (PubChem CID 67746421) has the molecular formula C15H21Cl2N3O3 and a molecular weight of 362.26 g/mol. Its IUPAC name is 2-(2,4-diaminophenoxy)acetic acid;N-methylaniline;dihydrochloride.
| Compound Name | 2-(2,4-diaminophenoxy)acetic acid;N-methylaniline;dihydrochloride |
|---|---|
| PubChem CID | 67746421 |
| Molecular Formula | C15H21Cl2N3O3 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-(2,4-diaminophenoxy)acetic acid;N-methylaniline;dihydrochloride |
| SMILES | CNc1ccccc1.Cl.Cl.Nc1ccc(OCC(=O)O)c(N)c1 |
| InChI | InChI=1S/C8H10N2O3.C7H9N.2ClH/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-8-7-5-3-2-4-6-7;;/h1-3H,4,9-10H2,(H,11,12);2-6,8H,1H3;2*1H |
| InChIKey | AXRAXXXHNAGDBE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|