C28H31N2O8P — CID 67748198
dibenzyl (2S)-2-[[ethoxy-[(4-nitrophenyl)methyl]phosphoryl]amino]pentanedioate (PubChem CID 67748198) has the molecular formula C28H31N2O8P and a molecular weight of 554.54 g/mol. Its IUPAC name is dibenzyl (2S)-2-[[ethoxy-[(4-nitrophenyl)methyl]phosphoryl]amino]pentanedioate.
| Compound Name | dibenzyl (2S)-2-[[ethoxy-[(4-nitrophenyl)methyl]phosphoryl]amino]pentanedioate |
|---|---|
| PubChem CID | 67748198 |
| Molecular Formula | C28H31N2O8P |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | dibenzyl (2S)-2-[[ethoxy-[(4-nitrophenyl)methyl]phosphoryl]amino]pentanedioate |
| SMILES | CCOP(=O)(Cc1ccc([N+](=O)[O-])cc1)N[C@@H](CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H31N2O8P/c1-2-38-39(35,21-24-13-15-25(16-14-24)30(33)34)29-26(28(32)37-20-23-11-7-4-8-12-23)17-18-27(31)36-19-22-9-5-3-6-10-22/h3-16,26H,2,17-21H2,1H3,(H,29,35)/t26-,39?/m0/s1 |
| InChIKey | LOBBDQIYUIPPEI-APBQMGQJSA-N |
| XLogP | 5.55 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|