C25H30N4O3 — CID 67754538
N-(2-carbamohydrazonoyl-4-oxochromen-8-yl)-9-phenylnonanamide (PubChem CID 67754538) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-(2-carbamohydrazonoyl-4-oxochromen-8-yl)-9-phenylnonanamide.
| Compound Name | N-(2-carbamohydrazonoyl-4-oxochromen-8-yl)-9-phenylnonanamide |
|---|---|
| PubChem CID | 67754538 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-(2-carbamohydrazonoyl-4-oxochromen-8-yl)-9-phenylnonanamide |
| SMILES | NN=C(N)c1cc(=O)c2cccc(NC(=O)CCCCCCCCc3ccccc3)c2o1 |
| InChI | InChI=1S/C25H30N4O3/c26-25(29-27)22-17-21(30)19-14-10-15-20(24(19)32-22)28-23(31)16-9-4-2-1-3-6-11-18-12-7-5-8-13-18/h5,7-8,10,12-15,17H,1-4,6,9,11,16,27H2,(H2,26,29)(H,28,31) |
| InChIKey | HYFOORXGMOFTGK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|