C26H26O6 — CID 67758790
[(1R,2R,3S,5S)-2,3-dihydroxy-5-(naphthalen-2-ylmethoxy)cyclohexyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 67758790) has the molecular formula C26H26O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is [(1R,2R,3S,5S)-2,3-dihydroxy-5-(naphthalen-2-ylmethoxy)cyclohexyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(1R,2R,3S,5S)-2,3-dihydroxy-5-(naphthalen-2-ylmethoxy)cyclohexyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 67758790 |
| Molecular Formula | C26H26O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | [(1R,2R,3S,5S)-2,3-dihydroxy-5-(naphthalen-2-ylmethoxy)cyclohexyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)cc1)O[C@@H]1C[C@@H](OCc2ccc3ccccc3c2)C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H26O6/c27-21-10-6-17(7-11-21)8-12-25(29)32-24-15-22(14-23(28)26(24)30)31-16-18-5-9-19-3-1-2-4-20(19)13-18/h1-13,22-24,26-28,30H,14-16H2/b12-8+/t22-,23-,24+,26+/m0/s1 |
| InChIKey | NJWJAPWCIBWLBP-YCPIPYKYSA-N |
| XLogP | 3.57 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|