C19H22F3N3O5 — CID 67773238
[(2S)-2-[[(E,3S)-6-(4-methoxyanilino)-6-oxohex-4-en-3-yl]carbamoyl]azetidin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 67773238) has the molecular formula C19H22F3N3O5 and a molecular weight of 429.40 g/mol. Its IUPAC name is [(2S)-2-[[(E,3S)-6-(4-methoxyanilino)-6-oxohex-4-en-3-yl]carbamoyl]azetidin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S)-2-[[(E,3S)-6-(4-methoxyanilino)-6-oxohex-4-en-3-yl]carbamoyl]azetidin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67773238 |
| Molecular Formula | C19H22F3N3O5 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [(2S)-2-[[(E,3S)-6-(4-methoxyanilino)-6-oxohex-4-en-3-yl]carbamoyl]azetidin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CC[C@@H](/C=C/C(=O)Nc1ccc(OC)cc1)NC(=O)[C@@H]1CCN1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H22F3N3O5/c1-3-12(6-9-16(26)23-13-4-7-14(29-2)8-5-13)24-17(27)15-10-11-25(15)30-18(28)19(20,21)22/h4-9,12,15H,3,10-11H2,1-2H3,(H,23,26)(H,24,27)/b9-6+/t12-,15-/m0/s1 |
| InChIKey | SOLAOTCQUYCQCH-XXQHYGDVSA-N |
| XLogP | 2.18 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|