C12H11NO2 — CID 67793619
1-(1,2-oxazol-5-yl)-3-phenylpropan-1-one (PubChem CID 67793619) has the molecular formula C12H11NO2 and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-(1,2-oxazol-5-yl)-3-phenylpropan-1-one.
| Compound Name | 1-(1,2-oxazol-5-yl)-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 67793619 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1-(1,2-oxazol-5-yl)-3-phenylpropan-1-one |
| SMILES | O=C(CCc1ccccc1)c1ccno1 |
| InChI | InChI=1S/C12H11NO2/c14-11(12-8-9-13-15-12)7-6-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2 |
| InChIKey | JPRWUQLNWRXPMR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |