C17H18F4O — CID 67799085
1-[4-butyl-4-(trifluoromethoxy)cyclohexa-2,5-dien-1-yl]-2-fluorobenzene (PubChem CID 67799085) has the molecular formula C17H18F4O and a molecular weight of 314.32 g/mol. Its IUPAC name is 1-[4-butyl-4-(trifluoromethoxy)cyclohexa-2,5-dien-1-yl]-2-fluorobenzene.
| Compound Name | 1-[4-butyl-4-(trifluoromethoxy)cyclohexa-2,5-dien-1-yl]-2-fluorobenzene |
|---|---|
| PubChem CID | 67799085 |
| Molecular Formula | C17H18F4O |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-[4-butyl-4-(trifluoromethoxy)cyclohexa-2,5-dien-1-yl]-2-fluorobenzene |
| SMILES | CCCCC1(OC(F)(F)F)C=CC(c2ccccc2F)C=C1 |
| InChI | InChI=1S/C17H18F4O/c1-2-3-10-16(22-17(19,20)21)11-8-13(9-12-16)14-6-4-5-7-15(14)18/h4-9,11-13H,2-3,10H2,1H3 |
| InChIKey | JPXHPZRFMXUIQN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|