C26H31NO6 — CID 67807798
(Z)-but-2-enedioic acid;1-[3-[(3R,4R)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]phenyl]propan-1-one (PubChem CID 67807798) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-[3-[(3R,4R)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]phenyl]propan-1-one.
| Compound Name | (Z)-but-2-enedioic acid;1-[3-[(3R,4R)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 67807798 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-[3-[(3R,4R)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]phenyl]propan-1-one |
| SMILES | CCC(=O)c1cccc(N2CC[C@@](C)(c3cccc(O)c3)[C@@H](C)C2)c1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C22H27NO2.C4H4O4/c1-4-21(25)17-7-5-9-19(13-17)23-12-11-22(3,16(2)15-23)18-8-6-10-20(24)14-18;5-3(6)1-2-4(7)8/h5-10,13-14,16,24H,4,11-12,15H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t16-,22+;/m0./s1 |
| InChIKey | XINBXOUHNUJIMO-QQJOOUDNSA-N |
| XLogP | 4.50 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|