C20H20N4O3 — CID 67809195
methyl 2-[2-[2-(4-cyanophenyl)pyrimidine-5-carbonyl]piperidin-4-yl]acetate (PubChem CID 67809195) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is methyl 2-[2-[2-(4-cyanophenyl)pyrimidine-5-carbonyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[2-[2-(4-cyanophenyl)pyrimidine-5-carbonyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 67809195 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | methyl 2-[2-[2-(4-cyanophenyl)pyrimidine-5-carbonyl]piperidin-4-yl]acetate |
| SMILES | COC(=O)CC1CCNC(C(=O)c2cnc(-c3ccc(C#N)cc3)nc2)C1 |
| InChI | InChI=1S/C20H20N4O3/c1-27-18(25)9-14-6-7-22-17(8-14)19(26)16-11-23-20(24-12-16)15-4-2-13(10-21)3-5-15/h2-5,11-12,14,17,22H,6-9H2,1H3 |
| InChIKey | LYHWMIVHOCLPJD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |