C15H11Cl2N3O6S — CID 67813126
(3-nitrophenyl)methyl 6,8-dichloro-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-3-carboxylate (PubChem CID 67813126) has the molecular formula C15H11Cl2N3O6S and a molecular weight of 432.24 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 6,8-dichloro-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-3-carboxylate.
| Compound Name | (3-nitrophenyl)methyl 6,8-dichloro-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-3-carboxylate |
|---|---|
| PubChem CID | 67813126 |
| Molecular Formula | C15H11Cl2N3O6S |
| Molecular Weight | 432.24 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | (3-nitrophenyl)methyl 6,8-dichloro-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-3-carboxylate |
| SMILES | O=C(OCc1cccc([N+](=O)[O-])c1)C1Nc2cc(Cl)cc(Cl)c2S(=O)(=O)N1 |
| InChI | InChI=1S/C15H11Cl2N3O6S/c16-9-5-11(17)13-12(6-9)18-14(19-27(13,24)25)15(21)26-7-8-2-1-3-10(4-8)20(22)23/h1-6,14,18-19H,7H2 |
| InChIKey | CHHQJMZSSZNMLW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|