C14H9Cl2N3O5S — CID 68663468
6,8-dichloro-2-[(3-nitrophenyl)methyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 68663468) has the molecular formula C14H9Cl2N3O5S and a molecular weight of 402.22 g/mol. Its IUPAC name is 6,8-dichloro-2-[(3-nitrophenyl)methyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 6,8-dichloro-2-[(3-nitrophenyl)methyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 68663468 |
| Molecular Formula | C14H9Cl2N3O5S |
| Molecular Weight | 402.22 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 6,8-dichloro-2-[(3-nitrophenyl)methyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | O=C1Nc2cc(Cl)cc(Cl)c2S(=O)(=O)N1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9Cl2N3O5S/c15-9-5-11(16)13-12(6-9)17-14(20)18(25(13,23)24)7-8-2-1-3-10(4-8)19(21)22/h1-6H,7H2,(H,17,20) |
| InChIKey | KVSOCSDEOFBNDE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|